C14H23FN2O3S — CID 106139845
3-amino-4-fluoro-N-(4-hydroxy-2,2-dimethylbutyl)-2,6-dimethylbenzenesulfonamide (PubChem CID 106139845) has the molecular formula C14H23FN2O3S and a molecular weight of 318.41 g/mol. Its IUPAC name is 3-amino-4-fluoro-N-(4-hydroxy-2,2-dimethylbutyl)-2,6-dimethylbenzenesulfonamide.
| Compound Name | 3-amino-4-fluoro-N-(4-hydroxy-2,2-dimethylbutyl)-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106139845 |
| Molecular Formula | C14H23FN2O3S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3-amino-4-fluoro-N-(4-hydroxy-2,2-dimethylbutyl)-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)c(N)c(C)c1S(=O)(=O)NCC(C)(C)CCO |
| InChI | InChI=1S/C14H23FN2O3S/c1-9-7-11(15)12(16)10(2)13(9)21(19,20)17-8-14(3,4)5-6-18/h7,17-18H,5-6,8,16H2,1-4H3 |
| InChIKey | GXTZGQXPEXPGHG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|