C11H15FN2O2S — CID 107325687
3-amino-4-fluoro-2,6-dimethyl-N-prop-2-enylbenzenesulfonamide (PubChem CID 107325687) has the molecular formula C11H15FN2O2S and a molecular weight of 258.32 g/mol. Its IUPAC name is 3-amino-4-fluoro-2,6-dimethyl-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 3-amino-4-fluoro-2,6-dimethyl-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 107325687 |
| Molecular Formula | C11H15FN2O2S |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 3-amino-4-fluoro-2,6-dimethyl-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCNS(=O)(=O)c1c(C)cc(F)c(N)c1C |
| InChI | InChI=1S/C11H15FN2O2S/c1-4-5-14-17(15,16)11-7(2)6-9(12)10(13)8(11)3/h4,6,14H,1,5,13H2,2-3H3 |
| InChIKey | SKEYWWBHKHINHG-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|