C13H20FN3O3S — CID 107325645
2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]-N-propan-2-ylacetamide (PubChem CID 107325645) has the molecular formula C13H20FN3O3S and a molecular weight of 317.39 g/mol. Its IUPAC name is 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 107325645 |
| Molecular Formula | C13H20FN3O3S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]-N-propan-2-ylacetamide |
| SMILES | Cc1cc(F)c(N)c(C)c1S(=O)(=O)NCC(=O)NC(C)C |
| InChI | InChI=1S/C13H20FN3O3S/c1-7(2)17-11(18)6-16-21(19,20)13-8(3)5-10(14)12(15)9(13)4/h5,7,16H,6,15H2,1-4H3,(H,17,18) |
| InChIKey | QREJYTPFSRZQLU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|