C13H20FN3O3S — CID 106095532
3-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 106095532) has the molecular formula C13H20FN3O3S and a molecular weight of 317.39 g/mol. Its IUPAC name is 3-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | 3-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106095532 |
| Molecular Formula | C13H20FN3O3S |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 3-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | Cc1cc(F)c(N)c(C)c1S(=O)(=O)NC(C)(C)CC(N)=O |
| InChI | InChI=1S/C13H20FN3O3S/c1-7-5-9(14)11(16)8(2)12(7)21(19,20)17-13(3,4)6-10(15)18/h5,17H,6,16H2,1-4H3,(H2,15,18) |
| InChIKey | ALDFMKDUDDHGFI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|