C11H15Br2N3O3S — CID 106095490
3-[(2-amino-4,6-dibromophenyl)sulfonylamino]-3-methylbutanamide (PubChem CID 106095490) has the molecular formula C11H15Br2N3O3S and a molecular weight of 429.13 g/mol. Its IUPAC name is 3-[(2-amino-4,6-dibromophenyl)sulfonylamino]-3-methylbutanamide.
| Compound Name | 3-[(2-amino-4,6-dibromophenyl)sulfonylamino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106095490 |
| Molecular Formula | C11H15Br2N3O3S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | 3-[(2-amino-4,6-dibromophenyl)sulfonylamino]-3-methylbutanamide |
| SMILES | CC(C)(CC(N)=O)NS(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C11H15Br2N3O3S/c1-11(2,5-9(15)17)16-20(18,19)10-7(13)3-6(12)4-8(10)14/h3-4,16H,5,14H2,1-2H3,(H2,15,17) |
| InChIKey | DTFJFMIIYIHTPX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|