C9H11Br2N3O3S — CID 43310321
2-[(2-amino-4,6-dibromophenyl)sulfonylamino]-N-methylacetamide (PubChem CID 43310321) has the molecular formula C9H11Br2N3O3S and a molecular weight of 401.08 g/mol. Its IUPAC name is 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 43310321 |
| Molecular Formula | C9H11Br2N3O3S |
| Molecular Weight | 401.08 g/mol |
| Exact Mass | 398.89 |
| IUPAC Name | 2-[(2-amino-4,6-dibromophenyl)sulfonylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C9H11Br2N3O3S/c1-13-8(15)4-14-18(16,17)9-6(11)2-5(10)3-7(9)12/h2-3,14H,4,12H2,1H3,(H,13,15) |
| InChIKey | LRDHZIZEUZWOLQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.08 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|