C9H12Br2N2O3S — CID 93081235
2-amino-4,6-dibromo-N-[(2S)-2-hydroxypropyl]benzenesulfonamide (PubChem CID 93081235) has the molecular formula C9H12Br2N2O3S and a molecular weight of 388.08 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-[(2S)-2-hydroxypropyl]benzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-[(2S)-2-hydroxypropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 93081235 |
| Molecular Formula | C9H12Br2N2O3S |
| Molecular Weight | 388.08 g/mol |
| Exact Mass | 385.89 |
| IUPAC Name | 2-amino-4,6-dibromo-N-[(2S)-2-hydroxypropyl]benzenesulfonamide |
| SMILES | C[C@H](O)CNS(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C9H12Br2N2O3S/c1-5(14)4-13-17(15,16)9-7(11)2-6(10)3-8(9)12/h2-3,5,13-14H,4,12H2,1H3/t5-/m0/s1 |
| InChIKey | HIXMCHWFSQVUBP-YFKPBYRVSA-N |
| XLogP | 1.45 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.08 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|