C11H15Br2N3O3S — CID 106233643
5-[(2-amino-4,6-dibromophenyl)sulfonylamino]pentanamide (PubChem CID 106233643) has the molecular formula C11H15Br2N3O3S and a molecular weight of 429.13 g/mol. Its IUPAC name is 5-[(2-amino-4,6-dibromophenyl)sulfonylamino]pentanamide.
| Compound Name | 5-[(2-amino-4,6-dibromophenyl)sulfonylamino]pentanamide |
|---|---|
| PubChem CID | 106233643 |
| Molecular Formula | C11H15Br2N3O3S |
| Molecular Weight | 429.13 g/mol |
| Exact Mass | 426.92 |
| IUPAC Name | 5-[(2-amino-4,6-dibromophenyl)sulfonylamino]pentanamide |
| SMILES | NC(=O)CCCCNS(=O)(=O)c1c(N)cc(Br)cc1Br |
| InChI | InChI=1S/C11H15Br2N3O3S/c12-7-5-8(13)11(9(14)6-7)20(18,19)16-4-2-1-3-10(15)17/h5-6,16H,1-4,14H2,(H2,15,17) |
| InChIKey | UWWLEIRIIJSJCP-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.13 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|