C13H18Br2N2O2S — CID 43371478
2-amino-4,6-dibromo-N-(cyclohexylmethyl)benzenesulfonamide (PubChem CID 43371478) has the molecular formula C13H18Br2N2O2S and a molecular weight of 426.17 g/mol. Its IUPAC name is 2-amino-4,6-dibromo-N-(cyclohexylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-4,6-dibromo-N-(cyclohexylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 43371478 |
| Molecular Formula | C13H18Br2N2O2S |
| Molecular Weight | 426.17 g/mol |
| Exact Mass | 423.95 |
| IUPAC Name | 2-amino-4,6-dibromo-N-(cyclohexylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(Br)cc(Br)c1S(=O)(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C13H18Br2N2O2S/c14-10-6-11(15)13(12(16)7-10)20(18,19)17-8-9-4-2-1-3-5-9/h6-7,9,17H,1-5,8,16H2 |
| InChIKey | WNZFMDRQMSZPJK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.17 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|