C10H10BrCl2NO2S — CID 60727630
4-bromo-2,6-dichloro-N-(cyclopropylmethyl)benzenesulfonamide (PubChem CID 60727630) has the molecular formula C10H10BrCl2NO2S and a molecular weight of 359.07 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(cyclopropylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(cyclopropylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60727630 |
| Molecular Formula | C10H10BrCl2NO2S |
| Molecular Weight | 359.07 g/mol |
| Exact Mass | 356.90 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(cyclopropylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CC1)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H10BrCl2NO2S/c11-7-3-8(12)10(9(13)4-7)17(15,16)14-5-6-1-2-6/h3-4,6,14H,1-2,5H2 |
| InChIKey | JDKDXNYPWVLOAG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.07 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |