C12H15BrClNO2S — CID 46406690
4-bromo-2-chloro-N-(cyclopentylmethyl)benzenesulfonamide (PubChem CID 46406690) has the molecular formula C12H15BrClNO2S and a molecular weight of 352.68 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(cyclopentylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-(cyclopentylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46406690 |
| Molecular Formula | C12H15BrClNO2S |
| Molecular Weight | 352.68 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 4-bromo-2-chloro-N-(cyclopentylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCC1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H15BrClNO2S/c13-10-5-6-12(11(14)7-10)18(16,17)15-8-9-3-1-2-4-9/h5-7,9,15H,1-4,8H2 |
| InChIKey | FJEGVHGURDRNLV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.68 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |