C11H13BrClNO3S — CID 42999359
4-bromo-2-chloro-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 42999359) has the molecular formula C11H13BrClNO3S and a molecular weight of 354.65 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 42999359 |
| Molecular Formula | C11H13BrClNO3S |
| Molecular Weight | 354.65 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | 4-bromo-2-chloro-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCO1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C11H13BrClNO3S/c12-8-3-4-11(10(13)6-8)18(15,16)14-7-9-2-1-5-17-9/h3-4,6,9,14H,1-2,5,7H2 |
| InChIKey | IGFLVYAVZNOZIK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.65 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |