C12H15BrClNO3S — CID 47406363
4-bromo-2-chloro-N-(oxan-2-ylmethyl)benzenesulfonamide (PubChem CID 47406363) has the molecular formula C12H15BrClNO3S and a molecular weight of 368.68 g/mol. Its IUPAC name is 4-bromo-2-chloro-N-(oxan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 4-bromo-2-chloro-N-(oxan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 47406363 |
| Molecular Formula | C12H15BrClNO3S |
| Molecular Weight | 368.68 g/mol |
| Exact Mass | 366.96 |
| IUPAC Name | 4-bromo-2-chloro-N-(oxan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCCO1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C12H15BrClNO3S/c13-9-4-5-12(11(14)7-9)19(16,17)15-8-10-3-1-2-6-18-10/h4-5,7,10,15H,1-3,6,8H2 |
| InChIKey | DDIYZNCOQUQMOR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.68 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |