C12H14BrCl2NO — CID 43591868
4-bromo-2,6-dichloro-N-(oxan-2-ylmethyl)aniline (PubChem CID 43591868) has the molecular formula C12H14BrCl2NO and a molecular weight of 339.06 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(oxan-2-ylmethyl)aniline.
| Compound Name | 4-bromo-2,6-dichloro-N-(oxan-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 43591868 |
| Molecular Formula | C12H14BrCl2NO |
| Molecular Weight | 339.06 g/mol |
| Exact Mass | 336.96 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(oxan-2-ylmethyl)aniline |
| SMILES | Clc1cc(Br)cc(Cl)c1NCC1CCCCO1 |
| InChI | InChI=1S/C12H14BrCl2NO/c13-8-5-10(14)12(11(15)6-8)16-7-9-3-1-2-4-17-9/h5-6,9,16H,1-4,7H2 |
| InChIKey | LZQBAGUOUAYPEN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.06 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |