C12H14BrNO3 — CID 102822430
3-bromo-5-(oxolan-2-ylmethylamino)benzoic acid (PubChem CID 102822430) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 3-bromo-5-(oxolan-2-ylmethylamino)benzoic acid.
| Compound Name | 3-bromo-5-(oxolan-2-ylmethylamino)benzoic acid |
|---|---|
| PubChem CID | 102822430 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3-bromo-5-(oxolan-2-ylmethylamino)benzoic acid |
| SMILES | O=C(O)c1cc(Br)cc(NCC2CCCO2)c1 |
| InChI | InChI=1S/C12H14BrNO3/c13-9-4-8(12(15)16)5-10(6-9)14-7-11-2-1-3-17-11/h4-6,11,14H,1-3,7H2,(H,15,16) |
| InChIKey | WQBZNQQUYZTGCV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |