C11H13ClFNO3S — CID 110759337
5-chloro-2-fluoro-N-(oxolan-2-ylmethyl)benzenesulfonamide (PubChem CID 110759337) has the molecular formula C11H13ClFNO3S and a molecular weight of 293.75 g/mol. Its IUPAC name is 5-chloro-2-fluoro-N-(oxolan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-N-(oxolan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 110759337 |
| Molecular Formula | C11H13ClFNO3S |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | 5-chloro-2-fluoro-N-(oxolan-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC1CCCO1)c1cc(Cl)ccc1F |
| InChI | InChI=1S/C11H13ClFNO3S/c12-8-3-4-10(13)11(6-8)18(15,16)14-7-9-2-1-5-17-9/h3-4,6,9,14H,1-2,5,7H2 |
| InChIKey | WTSZGFUJCSUDKB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |