C12H16BrClN2O2S — CID 124698506
5-bromo-2-chloro-N-[[(3S)-piperidin-3-yl]methyl]benzenesulfonamide (PubChem CID 124698506) has the molecular formula C12H16BrClN2O2S and a molecular weight of 367.70 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[(3S)-piperidin-3-yl]methyl]benzenesulfonamide.
| Compound Name | 5-bromo-2-chloro-N-[[(3S)-piperidin-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124698506 |
| Molecular Formula | C12H16BrClN2O2S |
| Molecular Weight | 367.70 g/mol |
| Exact Mass | 365.98 |
| IUPAC Name | 5-bromo-2-chloro-N-[[(3S)-piperidin-3-yl]methyl]benzenesulfonamide |
| SMILES | O=S(=O)(NC[C@H]1CCCNC1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C12H16BrClN2O2S/c13-10-3-4-11(14)12(6-10)19(17,18)16-8-9-2-1-5-15-7-9/h3-4,6,9,15-16H,1-2,5,7-8H2/t9-/m0/s1 |
| InChIKey | TWXTVMVAWWTDSX-VIFPVBQESA-N |
| XLogP | 2.38 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.70 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |