C13H18BrClN2O3S — CID 124686383
2-bromo-5-chloro-4-methoxy-N-[[(3S)-piperidin-3-yl]methyl]benzenesulfonamide (PubChem CID 124686383) has the molecular formula C13H18BrClN2O3S and a molecular weight of 397.72 g/mol. Its IUPAC name is 2-bromo-5-chloro-4-methoxy-N-[[(3S)-piperidin-3-yl]methyl]benzenesulfonamide.
| Compound Name | 2-bromo-5-chloro-4-methoxy-N-[[(3S)-piperidin-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124686383 |
| Molecular Formula | C13H18BrClN2O3S |
| Molecular Weight | 397.72 g/mol |
| Exact Mass | 395.99 |
| IUPAC Name | 2-bromo-5-chloro-4-methoxy-N-[[(3S)-piperidin-3-yl]methyl]benzenesulfonamide |
| SMILES | COc1cc(Br)c(S(=O)(=O)NC[C@H]2CCCNC2)cc1Cl |
| InChI | InChI=1S/C13H18BrClN2O3S/c1-20-12-5-10(14)13(6-11(12)15)21(18,19)17-8-9-3-2-4-16-7-9/h5-6,9,16-17H,2-4,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | HJXKAUGPYRFLEO-VIFPVBQESA-N |
| XLogP | 2.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |