C14H20Cl2N2O4S — CID 119968782
methyl 4-chloro-2-(piperidin-3-ylmethylsulfamoyl)benzoate;hydrochloride (PubChem CID 119968782) has the molecular formula C14H20Cl2N2O4S and a molecular weight of 383.30 g/mol. Its IUPAC name is methyl 4-chloro-2-(piperidin-3-ylmethylsulfamoyl)benzoate;hydrochloride.
| Compound Name | methyl 4-chloro-2-(piperidin-3-ylmethylsulfamoyl)benzoate;hydrochloride |
|---|---|
| PubChem CID | 119968782 |
| Molecular Formula | C14H20Cl2N2O4S |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 382.05 |
| IUPAC Name | methyl 4-chloro-2-(piperidin-3-ylmethylsulfamoyl)benzoate;hydrochloride |
| SMILES | COC(=O)c1ccc(Cl)cc1S(=O)(=O)NCC1CCCNC1.Cl |
| InChI | InChI=1S/C14H19ClN2O4S.ClH/c1-21-14(18)12-5-4-11(15)7-13(12)22(19,20)17-9-10-3-2-6-16-8-10;/h4-5,7,10,16-17H,2-3,6,8-9H2,1H3;1H |
| InChIKey | NLDLLMIBXGMLMD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |