C14H19ClN2O4S — CID 120722836
methyl 4-chloro-2-[(4-methylpiperidin-3-yl)sulfamoyl]benzoate (PubChem CID 120722836) has the molecular formula C14H19ClN2O4S and a molecular weight of 346.84 g/mol. Its IUPAC name is methyl 4-chloro-2-[(4-methylpiperidin-3-yl)sulfamoyl]benzoate.
| Compound Name | methyl 4-chloro-2-[(4-methylpiperidin-3-yl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 120722836 |
| Molecular Formula | C14H19ClN2O4S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | methyl 4-chloro-2-[(4-methylpiperidin-3-yl)sulfamoyl]benzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1S(=O)(=O)NC1CNCCC1C |
| InChI | InChI=1S/C14H19ClN2O4S/c1-9-5-6-16-8-12(9)17-22(19,20)13-7-10(15)3-4-11(13)14(18)21-2/h3-4,7,9,12,16-17H,5-6,8H2,1-2H3 |
| InChIKey | GMWCRYPTCGRIQT-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |