C14H17BrClNO2S — CID 63686492
N-(2-bicyclo[2.2.1]heptanylmethyl)-4-bromo-2-chlorobenzenesulfonamide (PubChem CID 63686492) has the molecular formula C14H17BrClNO2S and a molecular weight of 378.72 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-4-bromo-2-chlorobenzenesulfonamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-4-bromo-2-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 63686492 |
| Molecular Formula | C14H17BrClNO2S |
| Molecular Weight | 378.72 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-4-bromo-2-chlorobenzenesulfonamide |
| SMILES | O=S(=O)(NCC1CC2CCC1C2)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H17BrClNO2S/c15-12-3-4-14(13(16)7-12)20(18,19)17-8-11-6-9-1-2-10(11)5-9/h3-4,7,9-11,17H,1-2,5-6,8H2 |
| InChIKey | MXIQEKHHGRIYFU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |