C13H19BrN4O2S — CID 63683555
N-(2-bicyclo[2.2.1]heptanylmethyl)-5-bromo-2-hydrazinylpyridine-3-sulfonamide (PubChem CID 63683555) has the molecular formula C13H19BrN4O2S and a molecular weight of 375.29 g/mol. Its IUPAC name is N-(2-bicyclo[2.2.1]heptanylmethyl)-5-bromo-2-hydrazinylpyridine-3-sulfonamide.
| Compound Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-5-bromo-2-hydrazinylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63683555 |
| Molecular Formula | C13H19BrN4O2S |
| Molecular Weight | 375.29 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | N-(2-bicyclo[2.2.1]heptanylmethyl)-5-bromo-2-hydrazinylpyridine-3-sulfonamide |
| SMILES | NNc1ncc(Br)cc1S(=O)(=O)NCC1CC2CCC1C2 |
| InChI | InChI=1S/C13H19BrN4O2S/c14-11-5-12(13(18-15)16-7-11)21(19,20)17-6-10-4-8-1-2-9(10)3-8/h5,7-10,17H,1-4,6,15H2,(H,16,18) |
| InChIKey | LAHUARSCJRAQHI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.29 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|