C11H16BrN3O2S — CID 113464137
5-bromo-2-(methylamino)-N-[(2-methylcyclopropyl)methyl]pyridine-3-sulfonamide (PubChem CID 113464137) has the molecular formula C11H16BrN3O2S and a molecular weight of 334.24 g/mol. Its IUPAC name is 5-bromo-2-(methylamino)-N-[(2-methylcyclopropyl)methyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(methylamino)-N-[(2-methylcyclopropyl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113464137 |
| Molecular Formula | C11H16BrN3O2S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 5-bromo-2-(methylamino)-N-[(2-methylcyclopropyl)methyl]pyridine-3-sulfonamide |
| SMILES | CNc1ncc(Br)cc1S(=O)(=O)NCC1CC1C |
| InChI | InChI=1S/C11H16BrN3O2S/c1-7-3-8(7)5-15-18(16,17)10-4-9(12)6-14-11(10)13-2/h4,6-8,15H,3,5H2,1-2H3,(H,13,14) |
| InChIKey | XEBLBHOZBPGBFA-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |