C11H18BrN3O2S — CID 55043938
5-bromo-2-(methylamino)-N-(3-methylbutyl)pyridine-3-sulfonamide (PubChem CID 55043938) has the molecular formula C11H18BrN3O2S and a molecular weight of 336.26 g/mol. Its IUPAC name is 5-bromo-2-(methylamino)-N-(3-methylbutyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(methylamino)-N-(3-methylbutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 55043938 |
| Molecular Formula | C11H18BrN3O2S |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 335.03 |
| IUPAC Name | 5-bromo-2-(methylamino)-N-(3-methylbutyl)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(Br)cc1S(=O)(=O)NCCC(C)C |
| InChI | InChI=1S/C11H18BrN3O2S/c1-8(2)4-5-15-18(16,17)10-6-9(12)7-14-11(10)13-3/h6-8,15H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | JWTHKIZGFQIELN-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |