C11H18BrN3O4S2 — CID 79558831
5-bromo-2-(methylamino)-N-(2-methyl-2-methylsulfonylpropyl)pyridine-3-sulfonamide (PubChem CID 79558831) has the molecular formula C11H18BrN3O4S2 and a molecular weight of 400.32 g/mol. Its IUPAC name is 5-bromo-2-(methylamino)-N-(2-methyl-2-methylsulfonylpropyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(methylamino)-N-(2-methyl-2-methylsulfonylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 79558831 |
| Molecular Formula | C11H18BrN3O4S2 |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 5-bromo-2-(methylamino)-N-(2-methyl-2-methylsulfonylpropyl)pyridine-3-sulfonamide |
| SMILES | CNc1ncc(Br)cc1S(=O)(=O)NCC(C)(C)S(C)(=O)=O |
| InChI | InChI=1S/C11H18BrN3O4S2/c1-11(2,20(4,16)17)7-15-21(18,19)9-5-8(12)6-14-10(9)13-3/h5-6,15H,7H2,1-4H3,(H,13,14) |
| InChIKey | CJGFKXSEHSKATE-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 105.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |