About 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide
5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide (PubChem CID 103464359) has the molecular formula C14H24BrN3O2S
and a molecular weight of 378.34 g/mol. Its IUPAC name is 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide |
| PubChem CID | 103464359 |
| Molecular Formula | C14H24BrN3O2S |
| Molecular Weight | 378.34 g/mol |
| Exact Mass | 377.08 |
| IUPAC Name | 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ncc(Br)cc1S(=O)(=O)NCC(C)(C)CC |
| InChI | InChI=1S/C14H24BrN3O2S/c1-5-7-16-13-12(8-11(15)9-17-13)21(19,20)18-10-14(3,4)6-2/h8-9,18H,5-7,10H2,1-4H3,(H,16,17) |
| InChIKey | WAYZNNAIWPCWAQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.34 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide?
The IUPAC name of 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide (CID 103464359) is 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide.
What is the SMILES notation for 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide?
The canonical SMILES for 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide is CCCNc1ncc(Br)cc1S(=O)(=O)NCC(C)(C)CC.
What is the InChIKey of 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide?
The InChIKey is WAYZNNAIWPCWAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24BrN3O2S/c1-5-7-16-13-12(8-11(15)9-17-13)21(19,20)18-10-14(3,4)6-2/h8-9,18H,5-7,10H2,1-4H3,(H,16,17).
What are the key properties of 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide?
5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide has a molecular weight of 378.34 g/mol, XLogP of 3.38, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(2,2-dimethylbutyl)-2-(propylamino)pyridine-3-sulfonamide is sourced from PubChem (CID 103464359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).