C10H16BrN3O2S2 — CID 63962280
5-bromo-2-(ethylamino)-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide (PubChem CID 63962280) has the molecular formula C10H16BrN3O2S2 and a molecular weight of 354.30 g/mol. Its IUPAC name is 5-bromo-2-(ethylamino)-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(ethylamino)-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 63962280 |
| Molecular Formula | C10H16BrN3O2S2 |
| Molecular Weight | 354.30 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 5-bromo-2-(ethylamino)-N-(2-methylsulfanylethyl)pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)NCCSC |
| InChI | InChI=1S/C10H16BrN3O2S2/c1-3-12-10-9(6-8(11)7-13-10)18(15,16)14-4-5-17-2/h6-7,14H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | FIJLPPARBNTPRR-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|