C8H12BrN3O2S — CID 62148821
5-bromo-2-(ethylamino)-N-methylpyridine-3-sulfonamide (PubChem CID 62148821) has the molecular formula C8H12BrN3O2S and a molecular weight of 294.17 g/mol. Its IUPAC name is 5-bromo-2-(ethylamino)-N-methylpyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(ethylamino)-N-methylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62148821 |
| Molecular Formula | C8H12BrN3O2S |
| Molecular Weight | 294.17 g/mol |
| Exact Mass | 292.98 |
| IUPAC Name | 5-bromo-2-(ethylamino)-N-methylpyridine-3-sulfonamide |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)NC |
| InChI | InChI=1S/C8H12BrN3O2S/c1-3-11-8-7(15(13,14)10-2)4-6(9)5-12-8/h4-5,10H,3H2,1-2H3,(H,11,12) |
| InChIKey | FJWJBKQVZPXXHF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |