C12H20BrN3O3S — CID 104765396
5-bromo-2-(ethylamino)-N-(2-propan-2-yloxyethyl)pyridine-3-sulfonamide (PubChem CID 104765396) has the molecular formula C12H20BrN3O3S and a molecular weight of 366.28 g/mol. Its IUPAC name is 5-bromo-2-(ethylamino)-N-(2-propan-2-yloxyethyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(ethylamino)-N-(2-propan-2-yloxyethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 104765396 |
| Molecular Formula | C12H20BrN3O3S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 5-bromo-2-(ethylamino)-N-(2-propan-2-yloxyethyl)pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)NCCOC(C)C |
| InChI | InChI=1S/C12H20BrN3O3S/c1-4-14-12-11(7-10(13)8-15-12)20(17,18)16-5-6-19-9(2)3/h7-9,16H,4-6H2,1-3H3,(H,14,15) |
| InChIKey | WXBXHKQHYJSSSF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|