C10H17BrN4O4S2 — CID 62158378
5-bromo-2-(ethylamino)-N-(3-sulfamoylpropyl)pyridine-3-sulfonamide (PubChem CID 62158378) has the molecular formula C10H17BrN4O4S2 and a molecular weight of 401.31 g/mol. Its IUPAC name is 5-bromo-2-(ethylamino)-N-(3-sulfamoylpropyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-(ethylamino)-N-(3-sulfamoylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 62158378 |
| Molecular Formula | C10H17BrN4O4S2 |
| Molecular Weight | 401.31 g/mol |
| Exact Mass | 399.99 |
| IUPAC Name | 5-bromo-2-(ethylamino)-N-(3-sulfamoylpropyl)pyridine-3-sulfonamide |
| SMILES | CCNc1ncc(Br)cc1S(=O)(=O)NCCCS(N)(=O)=O |
| InChI | InChI=1S/C10H17BrN4O4S2/c1-2-13-10-9(6-8(11)7-14-10)21(18,19)15-4-3-5-20(12,16)17/h6-7,15H,2-5H2,1H3,(H,13,14)(H2,12,16,17) |
| InChIKey | VUQPVWGNHXIAOT-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 131.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|