C9H12BrClN2O4S2 — CID 61301034
5-bromo-2-chloro-N-(3-methylsulfonylpropyl)pyridine-3-sulfonamide (PubChem CID 61301034) has the molecular formula C9H12BrClN2O4S2 and a molecular weight of 391.70 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(3-methylsulfonylpropyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-(3-methylsulfonylpropyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61301034 |
| Molecular Formula | C9H12BrClN2O4S2 |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 5-bromo-2-chloro-N-(3-methylsulfonylpropyl)pyridine-3-sulfonamide |
| SMILES | CS(=O)(=O)CCCNS(=O)(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C9H12BrClN2O4S2/c1-18(14,15)4-2-3-13-19(16,17)8-5-7(10)6-12-9(8)11/h5-6,13H,2-4H2,1H3 |
| InChIKey | QDJYFJMUMIWVNY-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|