C12H18BrClN2O2S — CID 78966663
5-bromo-2-chloro-N-(2,3,3-trimethylbutyl)pyridine-3-sulfonamide (PubChem CID 78966663) has the molecular formula C12H18BrClN2O2S and a molecular weight of 369.71 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2,3,3-trimethylbutyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-(2,3,3-trimethylbutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 78966663 |
| Molecular Formula | C12H18BrClN2O2S |
| Molecular Weight | 369.71 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | 5-bromo-2-chloro-N-(2,3,3-trimethylbutyl)pyridine-3-sulfonamide |
| SMILES | CC(CNS(=O)(=O)c1cc(Br)cnc1Cl)C(C)(C)C |
| InChI | InChI=1S/C12H18BrClN2O2S/c1-8(12(2,3)4)6-16-19(17,18)10-5-9(13)7-15-11(10)14/h5,7-8,16H,6H2,1-4H3 |
| InChIKey | VGAUCQIZOUFAIT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.71 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|