C14H22BrNO2S — CID 83147355
5-bromo-2-methyl-N-(2,3,3-trimethylbutyl)benzenesulfonamide (PubChem CID 83147355) has the molecular formula C14H22BrNO2S and a molecular weight of 348.31 g/mol. Its IUPAC name is 5-bromo-2-methyl-N-(2,3,3-trimethylbutyl)benzenesulfonamide.
| Compound Name | 5-bromo-2-methyl-N-(2,3,3-trimethylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 83147355 |
| Molecular Formula | C14H22BrNO2S |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 5-bromo-2-methyl-N-(2,3,3-trimethylbutyl)benzenesulfonamide |
| SMILES | Cc1ccc(Br)cc1S(=O)(=O)NCC(C)C(C)(C)C |
| InChI | InChI=1S/C14H22BrNO2S/c1-10-6-7-12(15)8-13(10)19(17,18)16-9-11(2)14(3,4)5/h6-8,11,16H,9H2,1-5H3 |
| InChIKey | GCTGJAGEGIITNX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |