C12H18BrClN2O2S2 — CID 103698220
5-bromo-2-chloro-N-(2-ethyl-2-methylsulfanylbutyl)pyridine-3-sulfonamide (PubChem CID 103698220) has the molecular formula C12H18BrClN2O2S2 and a molecular weight of 401.78 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(2-ethyl-2-methylsulfanylbutyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-(2-ethyl-2-methylsulfanylbutyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103698220 |
| Molecular Formula | C12H18BrClN2O2S2 |
| Molecular Weight | 401.78 g/mol |
| Exact Mass | 399.97 |
| IUPAC Name | 5-bromo-2-chloro-N-(2-ethyl-2-methylsulfanylbutyl)pyridine-3-sulfonamide |
| SMILES | CCC(CC)(CNS(=O)(=O)c1cc(Br)cnc1Cl)SC |
| InChI | InChI=1S/C12H18BrClN2O2S2/c1-4-12(5-2,19-3)8-16-20(17,18)10-6-9(13)7-15-11(10)14/h6-7,16H,4-5,8H2,1-3H3 |
| InChIKey | BJJRXHDYPLVJJV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.78 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|