C10H12BrClN2O2S — CID 103526952
5-bromo-2-chloro-N-(3-methylbut-2-enyl)pyridine-3-sulfonamide (PubChem CID 103526952) has the molecular formula C10H12BrClN2O2S and a molecular weight of 339.64 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(3-methylbut-2-enyl)pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-(3-methylbut-2-enyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 103526952 |
| Molecular Formula | C10H12BrClN2O2S |
| Molecular Weight | 339.64 g/mol |
| Exact Mass | 337.95 |
| IUPAC Name | 5-bromo-2-chloro-N-(3-methylbut-2-enyl)pyridine-3-sulfonamide |
| SMILES | CC(C)=CCNS(=O)(=O)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C10H12BrClN2O2S/c1-7(2)3-4-14-17(15,16)9-5-8(11)6-13-10(9)12/h3,5-6,14H,4H2,1-2H3 |
| InChIKey | HBFYOEWADJLWNR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.64 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|