C10H12BrClN2O3S — CID 113313207
5-bromo-2-chloro-N-[[1-(hydroxymethyl)cyclopropyl]methyl]pyridine-3-sulfonamide (PubChem CID 113313207) has the molecular formula C10H12BrClN2O3S and a molecular weight of 355.64 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[1-(hydroxymethyl)cyclopropyl]methyl]pyridine-3-sulfonamide.
| Compound Name | 5-bromo-2-chloro-N-[[1-(hydroxymethyl)cyclopropyl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113313207 |
| Molecular Formula | C10H12BrClN2O3S |
| Molecular Weight | 355.64 g/mol |
| Exact Mass | 353.94 |
| IUPAC Name | 5-bromo-2-chloro-N-[[1-(hydroxymethyl)cyclopropyl]methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC1(CO)CC1)c1cc(Br)cnc1Cl |
| InChI | InChI=1S/C10H12BrClN2O3S/c11-7-3-8(9(12)13-4-7)18(16,17)14-5-10(6-15)1-2-10/h3-4,14-15H,1-2,5-6H2 |
| InChIKey | YQXPBSXGMMRWGA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.64 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|