C13H19ClN2O3S — CID 115755597
2-chloro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pyridine-3-sulfonamide (PubChem CID 115755597) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is 2-chloro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 115755597 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-chloro-N-[[1-(hydroxymethyl)cyclohexyl]methyl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC1(CO)CCCCC1)c1cccnc1Cl |
| InChI | InChI=1S/C13H19ClN2O3S/c14-12-11(5-4-8-15-12)20(18,19)16-9-13(10-17)6-2-1-3-7-13/h4-5,8,16-17H,1-3,6-7,9-10H2 |
| InChIKey | LYDGSLQUEXWXST-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|