C12H16ClN3O4S — CID 146372173
2-[[(2-chloro-3-pyridinyl)sulfonylamino]methyl]-2-methylpyrrolidine-1-carboxylic acid (PubChem CID 146372173) has the molecular formula C12H16ClN3O4S and a molecular weight of 333.80 g/mol. Its IUPAC name is 2-[[(2-chloro-3-pyridinyl)sulfonylamino]methyl]-2-methylpyrrolidine-1-carboxylic acid.
| Compound Name | 2-[[(2-chloro-3-pyridinyl)sulfonylamino]methyl]-2-methylpyrrolidine-1-carboxylic acid |
|---|---|
| PubChem CID | 146372173 |
| Molecular Formula | C12H16ClN3O4S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | 2-[[(2-chloro-3-pyridinyl)sulfonylamino]methyl]-2-methylpyrrolidine-1-carboxylic acid |
| SMILES | CC1(CNS(=O)(=O)c2cccnc2Cl)CCCN1C(=O)O |
| InChI | InChI=1S/C12H16ClN3O4S/c1-12(5-3-7-16(12)11(17)18)8-15-21(19,20)9-4-2-6-14-10(9)13/h2,4,6,15H,3,5,7-8H2,1H3,(H,17,18) |
| InChIKey | GJGYMSYQEOKEJM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|