C9H11ClN2O5S — CID 104934121
(2S)-4-[(2-chloro-3-pyridinyl)sulfonylamino]-2-hydroxybutanoic acid (PubChem CID 104934121) has the molecular formula C9H11ClN2O5S and a molecular weight of 294.72 g/mol. Its IUPAC name is (2S)-4-[(2-chloro-3-pyridinyl)sulfonylamino]-2-hydroxybutanoic acid.
| Compound Name | (2S)-4-[(2-chloro-3-pyridinyl)sulfonylamino]-2-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104934121 |
| Molecular Formula | C9H11ClN2O5S |
| Molecular Weight | 294.72 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | (2S)-4-[(2-chloro-3-pyridinyl)sulfonylamino]-2-hydroxybutanoic acid |
| SMILES | O=C(O)[C@@H](O)CCNS(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C9H11ClN2O5S/c10-8-7(2-1-4-11-8)18(16,17)12-5-3-6(13)9(14)15/h1-2,4,6,12-13H,3,5H2,(H,14,15)/t6-/m0/s1 |
| InChIKey | QWQPSOAMTNRGNY-LURJTMIESA-N |
| XLogP | -0.15 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.72 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|