C11H17ClN2O4S — CID 61250348
2-chloro-N-[3-(2-methoxyethoxy)propyl]pyridine-3-sulfonamide (PubChem CID 61250348) has the molecular formula C11H17ClN2O4S and a molecular weight of 308.79 g/mol. Its IUPAC name is 2-chloro-N-[3-(2-methoxyethoxy)propyl]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[3-(2-methoxyethoxy)propyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61250348 |
| Molecular Formula | C11H17ClN2O4S |
| Molecular Weight | 308.79 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-chloro-N-[3-(2-methoxyethoxy)propyl]pyridine-3-sulfonamide |
| SMILES | COCCOCCCNS(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C11H17ClN2O4S/c1-17-8-9-18-7-3-6-14-19(15,16)10-4-2-5-13-11(10)12/h2,4-5,14H,3,6-9H2,1H3 |
| InChIKey | VKXIKAXBMJHWDL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.79 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|