C11H17ClN2O2S — CID 61046913
2-chloro-N-(4-methylpentyl)pyridine-3-sulfonamide (PubChem CID 61046913) has the molecular formula C11H17ClN2O2S and a molecular weight of 276.79 g/mol. Its IUPAC name is 2-chloro-N-(4-methylpentyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(4-methylpentyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61046913 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-chloro-N-(4-methylpentyl)pyridine-3-sulfonamide |
| SMILES | CC(C)CCCNS(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C11H17ClN2O2S/c1-9(2)5-3-8-14-17(15,16)10-6-4-7-13-11(10)12/h4,6-7,9,14H,3,5,8H2,1-2H3 |
| InChIKey | JRSVPNLXRWUCEZ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|