C11H11ClN2O2S2 — CID 54953527
2-chloro-N-(2-thiophen-3-ylethyl)pyridine-3-sulfonamide (PubChem CID 54953527) has the molecular formula C11H11ClN2O2S2 and a molecular weight of 302.81 g/mol. Its IUPAC name is 2-chloro-N-(2-thiophen-3-ylethyl)pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-(2-thiophen-3-ylethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 54953527 |
| Molecular Formula | C11H11ClN2O2S2 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | 2-chloro-N-(2-thiophen-3-ylethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCCc1ccsc1)c1cccnc1Cl |
| InChI | InChI=1S/C11H11ClN2O2S2/c12-11-10(2-1-5-13-11)18(15,16)14-6-3-9-4-7-17-8-9/h1-2,4-5,7-8,14H,3,6H2 |
| InChIKey | SIRFMXOSWFFGHN-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|