C15H20N2O2S2 — CID 106050066
2-methyl-3-(methylaminomethyl)-N-(2-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 106050066) has the molecular formula C15H20N2O2S2 and a molecular weight of 324.47 g/mol. Its IUPAC name is 2-methyl-3-(methylaminomethyl)-N-(2-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 2-methyl-3-(methylaminomethyl)-N-(2-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106050066 |
| Molecular Formula | C15H20N2O2S2 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 2-methyl-3-(methylaminomethyl)-N-(2-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | CNCc1cccc(S(=O)(=O)NCCc2ccsc2)c1C |
| InChI | InChI=1S/C15H20N2O2S2/c1-12-14(10-16-2)4-3-5-15(12)21(18,19)17-8-6-13-7-9-20-11-13/h3-5,7,9,11,16-17H,6,8,10H2,1-2H3 |
| InChIKey | QJAYKBGTJALCSC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |