C11H15ClN2O4S — CID 61142213
(2S)-2-[(2-chloro-3-pyridinyl)sulfonylamino]-3,3-dimethylbutanoic acid (PubChem CID 61142213) has the molecular formula C11H15ClN2O4S and a molecular weight of 306.77 g/mol. Its IUPAC name is (2S)-2-[(2-chloro-3-pyridinyl)sulfonylamino]-3,3-dimethylbutanoic acid.
| Compound Name | (2S)-2-[(2-chloro-3-pyridinyl)sulfonylamino]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 61142213 |
| Molecular Formula | C11H15ClN2O4S |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | (2S)-2-[(2-chloro-3-pyridinyl)sulfonylamino]-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(C)[C@H](NS(=O)(=O)c1cccnc1Cl)C(=O)O |
| InChI | InChI=1S/C11H15ClN2O4S/c1-11(2,3)8(10(15)16)14-19(17,18)7-5-4-6-13-9(7)12/h4-6,8,14H,1-3H3,(H,15,16)/t8-/m1/s1 |
| InChIKey | LKESFNOPCRBXNV-MRVPVSSYSA-N |
| XLogP | 1.51 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|