C11H16ClN3O3S — CID 60716062
2-[(2-chloro-3-pyridinyl)sulfonylamino]-N-propylpropanamide (PubChem CID 60716062) has the molecular formula C11H16ClN3O3S and a molecular weight of 305.79 g/mol. Its IUPAC name is 2-[(2-chloro-3-pyridinyl)sulfonylamino]-N-propylpropanamide.
| Compound Name | 2-[(2-chloro-3-pyridinyl)sulfonylamino]-N-propylpropanamide |
|---|---|
| PubChem CID | 60716062 |
| Molecular Formula | C11H16ClN3O3S |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 2-[(2-chloro-3-pyridinyl)sulfonylamino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)NS(=O)(=O)c1cccnc1Cl |
| InChI | InChI=1S/C11H16ClN3O3S/c1-3-6-14-11(16)8(2)15-19(17,18)9-5-4-7-13-10(9)12/h4-5,7-8,15H,3,6H2,1-2H3,(H,14,16) |
| InChIKey | UYDJHXABNISKGR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|