C13H22N4O3S — CID 62152812
N-ethyl-2-[[2-(propylamino)-3-pyridinyl]sulfonylamino]propanamide (PubChem CID 62152812) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is N-ethyl-2-[[2-(propylamino)-3-pyridinyl]sulfonylamino]propanamide.
| Compound Name | N-ethyl-2-[[2-(propylamino)-3-pyridinyl]sulfonylamino]propanamide |
|---|---|
| PubChem CID | 62152812 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N-ethyl-2-[[2-(propylamino)-3-pyridinyl]sulfonylamino]propanamide |
| SMILES | CCCNc1ncccc1S(=O)(=O)NC(C)C(=O)NCC |
| InChI | InChI=1S/C13H22N4O3S/c1-4-8-15-12-11(7-6-9-16-12)21(19,20)17-10(3)13(18)14-5-2/h6-7,9-10,17H,4-5,8H2,1-3H3,(H,14,18)(H,15,16) |
| InChIKey | QDBFTNSHCYYMET-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |