C10H15F2N3O2S — CID 113304047
N-(2,2-difluoroethyl)-2-(propylamino)pyridine-3-sulfonamide (PubChem CID 113304047) has the molecular formula C10H15F2N3O2S and a molecular weight of 279.31 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-2-(propylamino)pyridine-3-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-2-(propylamino)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113304047 |
| Molecular Formula | C10H15F2N3O2S |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | N-(2,2-difluoroethyl)-2-(propylamino)pyridine-3-sulfonamide |
| SMILES | CCCNc1ncccc1S(=O)(=O)NCC(F)F |
| InChI | InChI=1S/C10H15F2N3O2S/c1-2-5-13-10-8(4-3-6-14-10)18(16,17)15-7-9(11)12/h3-4,6,9,15H,2,5,7H2,1H3,(H,13,14) |
| InChIKey | GMCHWKTYMTXWBW-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |