C12H20N4O4S — CID 106240994
2-[2-[[2-(propylamino)-3-pyridinyl]sulfonylamino]ethoxy]acetamide (PubChem CID 106240994) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is 2-[2-[[2-(propylamino)-3-pyridinyl]sulfonylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[[2-(propylamino)-3-pyridinyl]sulfonylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106240994 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 2-[2-[[2-(propylamino)-3-pyridinyl]sulfonylamino]ethoxy]acetamide |
| SMILES | CCCNc1ncccc1S(=O)(=O)NCCOCC(N)=O |
| InChI | InChI=1S/C12H20N4O4S/c1-2-5-14-12-10(4-3-6-15-12)21(18,19)16-7-8-20-9-11(13)17/h3-4,6,16H,2,5,7-9H2,1H3,(H2,13,17)(H,14,15) |
| InChIKey | YDDJRKSZPSMQEZ-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|