C11H15ClN2O2S2 — CID 80527113
2-chloro-N-[(2-methylthiolan-2-yl)methyl]pyridine-3-sulfonamide (PubChem CID 80527113) has the molecular formula C11H15ClN2O2S2 and a molecular weight of 306.84 g/mol. Its IUPAC name is 2-chloro-N-[(2-methylthiolan-2-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | 2-chloro-N-[(2-methylthiolan-2-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 80527113 |
| Molecular Formula | C11H15ClN2O2S2 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | 2-chloro-N-[(2-methylthiolan-2-yl)methyl]pyridine-3-sulfonamide |
| SMILES | CC1(CNS(=O)(=O)c2cccnc2Cl)CCCS1 |
| InChI | InChI=1S/C11H15ClN2O2S2/c1-11(5-3-7-17-11)8-14-18(15,16)9-4-2-6-13-10(9)12/h2,4,6,14H,3,5,7-8H2,1H3 |
| InChIKey | DRVXSYQUWQMZGT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|