C12H17N3O2S3 — CID 106597633
3-[(2-methylthiolan-2-yl)methylsulfamoyl]pyridine-2-carbothioamide (PubChem CID 106597633) has the molecular formula C12H17N3O2S3 and a molecular weight of 331.49 g/mol. Its IUPAC name is 3-[(2-methylthiolan-2-yl)methylsulfamoyl]pyridine-2-carbothioamide.
| Compound Name | 3-[(2-methylthiolan-2-yl)methylsulfamoyl]pyridine-2-carbothioamide |
|---|---|
| PubChem CID | 106597633 |
| Molecular Formula | C12H17N3O2S3 |
| Molecular Weight | 331.49 g/mol |
| Exact Mass | 331.05 |
| IUPAC Name | 3-[(2-methylthiolan-2-yl)methylsulfamoyl]pyridine-2-carbothioamide |
| SMILES | CC1(CNS(=O)(=O)c2cccnc2C(N)=S)CCCS1 |
| InChI | InChI=1S/C12H17N3O2S3/c1-12(5-3-7-19-12)8-15-20(16,17)9-4-2-6-14-10(9)11(13)18/h2,4,6,15H,3,5,7-8H2,1H3,(H2,13,18) |
| InChIKey | AXZXSPMDHFLIEK-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.49 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|